C18H14ClF — CID 139730121
1-[2-(4-but-3-enylphenyl)ethynyl]-4-chloro-2-fluorobenzene (PubChem CID 139730121) has the molecular formula C18H14ClF and a molecular weight of 284.76 g/mol. Its IUPAC name is 1-[2-(4-but-3-enylphenyl)ethynyl]-4-chloro-2-fluorobenzene.
| Compound Name | 1-[2-(4-but-3-enylphenyl)ethynyl]-4-chloro-2-fluorobenzene |
|---|---|
| PubChem CID | 139730121 |
| Molecular Formula | C18H14ClF |
| Molecular Weight | 284.76 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-[2-(4-but-3-enylphenyl)ethynyl]-4-chloro-2-fluorobenzene |
| SMILES | C=CCCc1ccc(C#Cc2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C18H14ClF/c1-2-3-4-14-5-7-15(8-6-14)9-10-16-11-12-17(19)13-18(16)20/h2,5-8,11-13H,1,3-4H2 |
| InChIKey | AMJNFUGNRUAPFM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.76 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|