C20H18ClF — CID 139730157
4-chloro-2-fluoro-1-[2-(4-hex-3-enylphenyl)ethynyl]benzene (PubChem CID 139730157) has the molecular formula C20H18ClF and a molecular weight of 312.82 g/mol. Its IUPAC name is 4-chloro-2-fluoro-1-[2-(4-hex-3-enylphenyl)ethynyl]benzene.
| Compound Name | 4-chloro-2-fluoro-1-[2-(4-hex-3-enylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 139730157 |
| Molecular Formula | C20H18ClF |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 4-chloro-2-fluoro-1-[2-(4-hex-3-enylphenyl)ethynyl]benzene |
| SMILES | CCC=CCCc1ccc(C#Cc2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C20H18ClF/c1-2-3-4-5-6-16-7-9-17(10-8-16)11-12-18-13-14-19(21)15-20(18)22/h3-4,7-10,13-15H,2,5-6H2,1H3 |
| InChIKey | GWOZILNWUBQLGJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|