C17H14ClFO — CID 139730199
4-chloro-1-[2-[4-(ethoxymethyl)phenyl]ethynyl]-2-fluorobenzene (PubChem CID 139730199) has the molecular formula C17H14ClFO and a molecular weight of 288.75 g/mol. Its IUPAC name is 4-chloro-1-[2-[4-(ethoxymethyl)phenyl]ethynyl]-2-fluorobenzene.
| Compound Name | 4-chloro-1-[2-[4-(ethoxymethyl)phenyl]ethynyl]-2-fluorobenzene |
|---|---|
| PubChem CID | 139730199 |
| Molecular Formula | C17H14ClFO |
| Molecular Weight | 288.75 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 4-chloro-1-[2-[4-(ethoxymethyl)phenyl]ethynyl]-2-fluorobenzene |
| SMILES | CCOCc1ccc(C#Cc2ccc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C17H14ClFO/c1-2-20-12-14-5-3-13(4-6-14)7-8-15-9-10-16(18)11-17(15)19/h3-6,9-11H,2,12H2,1H3 |
| InChIKey | IKSQYUSFYZKWFQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.75 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|