C25H18F4 — CID 139799013
2-(3,4-difluorophenyl)-1,3-difluoro-5-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]benzene (PubChem CID 139799013) has the molecular formula C25H18F4 and a molecular weight of 394.41 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-1,3-difluoro-5-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]benzene.
| Compound Name | 2-(3,4-difluorophenyl)-1,3-difluoro-5-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 139799013 |
| Molecular Formula | C25H18F4 |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-(3,4-difluorophenyl)-1,3-difluoro-5-[2-[4-[(E)-pent-3-enyl]phenyl]ethynyl]benzene |
| SMILES | C/C=C/CCc1ccc(C#Cc2cc(F)c(-c3ccc(F)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C25H18F4/c1-2-3-4-5-17-6-8-18(9-7-17)10-11-19-14-23(28)25(24(29)15-19)20-12-13-21(26)22(27)16-20/h2-3,6-9,12-16H,4-5H2,1H3/b3-2+ |
| InChIKey | WMNFANQFLYORCY-NSCUHMNNSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|