C29H22F2 — CID 139857042
2-fluoro-6-[2-[2-fluoro-4-[4-[(E)-pent-3-enyl]phenyl]phenyl]ethynyl]naphthalene (PubChem CID 139857042) has the molecular formula C29H22F2 and a molecular weight of 408.49 g/mol. Its IUPAC name is 2-fluoro-6-[2-[2-fluoro-4-[4-[(E)-pent-3-enyl]phenyl]phenyl]ethynyl]naphthalene.
| Compound Name | 2-fluoro-6-[2-[2-fluoro-4-[4-[(E)-pent-3-enyl]phenyl]phenyl]ethynyl]naphthalene |
|---|---|
| PubChem CID | 139857042 |
| Molecular Formula | C29H22F2 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2-fluoro-6-[2-[2-fluoro-4-[4-[(E)-pent-3-enyl]phenyl]phenyl]ethynyl]naphthalene |
| SMILES | C/C=C/CCc1ccc(-c2ccc(C#Cc3ccc4cc(F)ccc4c3)c(F)c2)cc1 |
| InChI | InChI=1S/C29H22F2/c1-2-3-4-5-21-6-10-23(11-7-21)27-15-14-24(29(31)20-27)12-8-22-9-13-26-19-28(30)17-16-25(26)18-22/h2-3,6-7,9-11,13-20H,4-5H2,1H3/b3-2+ |
| InChIKey | HWICVXONCOJKAX-NSCUHMNNSA-N |
| XLogP | 7.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|