C27H19F3N2 — CID 139858561
2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3-fluorophenyl]-5-[(E)-pent-3-enyl]pyrimidine (PubChem CID 139858561) has the molecular formula C27H19F3N2 and a molecular weight of 428.46 g/mol. Its IUPAC name is 2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3-fluorophenyl]-5-[(E)-pent-3-enyl]pyrimidine.
| Compound Name | 2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3-fluorophenyl]-5-[(E)-pent-3-enyl]pyrimidine |
|---|---|
| PubChem CID | 139858561 |
| Molecular Formula | C27H19F3N2 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 2-[4-[2-(6,7-difluoronaphthalen-2-yl)ethynyl]-3-fluorophenyl]-5-[(E)-pent-3-enyl]pyrimidine |
| SMILES | C/C=C/CCc1cnc(-c2ccc(C#Cc3ccc4cc(F)c(F)cc4c3)c(F)c2)nc1 |
| InChI | InChI=1S/C27H19F3N2/c1-2-3-4-5-19-16-31-27(32-17-19)22-11-10-20(24(28)14-22)8-6-18-7-9-21-13-25(29)26(30)15-23(21)12-18/h2-3,7,9-17H,4-5H2,1H3/b3-2+ |
| InChIKey | UCVSZXGIGNQEEA-NSCUHMNNSA-N |
| XLogP | 6.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|