C26H20F2N2 — CID 139858362
5-butyl-2-[3-fluoro-4-[2-(6-fluoronaphthalen-2-yl)ethynyl]phenyl]pyrimidine (PubChem CID 139858362) has the molecular formula C26H20F2N2 and a molecular weight of 398.46 g/mol. Its IUPAC name is 5-butyl-2-[3-fluoro-4-[2-(6-fluoronaphthalen-2-yl)ethynyl]phenyl]pyrimidine.
| Compound Name | 5-butyl-2-[3-fluoro-4-[2-(6-fluoronaphthalen-2-yl)ethynyl]phenyl]pyrimidine |
|---|---|
| PubChem CID | 139858362 |
| Molecular Formula | C26H20F2N2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 5-butyl-2-[3-fluoro-4-[2-(6-fluoronaphthalen-2-yl)ethynyl]phenyl]pyrimidine |
| SMILES | CCCCc1cnc(-c2ccc(C#Cc3ccc4cc(F)ccc4c3)c(F)c2)nc1 |
| InChI | InChI=1S/C26H20F2N2/c1-2-3-4-19-16-29-26(30-17-19)23-10-9-20(25(28)15-23)7-5-18-6-8-22-14-24(27)12-11-21(22)13-18/h6,8-17H,2-4H2,1H3 |
| InChIKey | ZIHCAUGBKDAJKT-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|