C28H20F2O — CID 139859178
2-[2-[4-[4-[(E)-but-2-enoxy]phenyl]-2-fluorophenyl]ethynyl]-6-fluoronaphthalene (PubChem CID 139859178) has the molecular formula C28H20F2O and a molecular weight of 410.46 g/mol. Its IUPAC name is 2-[2-[4-[4-[(E)-but-2-enoxy]phenyl]-2-fluorophenyl]ethynyl]-6-fluoronaphthalene.
| Compound Name | 2-[2-[4-[4-[(E)-but-2-enoxy]phenyl]-2-fluorophenyl]ethynyl]-6-fluoronaphthalene |
|---|---|
| PubChem CID | 139859178 |
| Molecular Formula | C28H20F2O |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[2-[4-[4-[(E)-but-2-enoxy]phenyl]-2-fluorophenyl]ethynyl]-6-fluoronaphthalene |
| SMILES | C/C=C/COc1ccc(-c2ccc(C#Cc3ccc4cc(F)ccc4c3)c(F)c2)cc1 |
| InChI | InChI=1S/C28H20F2O/c1-2-3-16-31-27-14-11-21(12-15-27)25-9-8-22(28(30)19-25)6-4-20-5-7-24-18-26(29)13-10-23(24)17-20/h2-3,5,7-15,17-19H,16H2,1H3/b3-2+ |
| InChIKey | JYYVZOHHUICVMC-NSCUHMNNSA-N |
| XLogP | 7.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|