C14H12F2N2 — CID 19380417
5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine (PubChem CID 19380417) has the molecular formula C14H12F2N2 and a molecular weight of 246.26 g/mol. Its IUPAC name is 5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine.
| Compound Name | 5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine |
|---|---|
| PubChem CID | 19380417 |
| Molecular Formula | C14H12F2N2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine |
| SMILES | C=CCCc1cnc(-c2ccc(F)c(F)c2)nc1 |
| InChI | InChI=1S/C14H12F2N2/c1-2-3-4-10-8-17-14(18-9-10)11-5-6-12(15)13(16)7-11/h2,5-9H,1,3-4H2 |
| InChIKey | RHKPUQKTFJLXQF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|