About 5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine
5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine (PubChem CID 19380417) has the molecular formula C14H12F2N2
and a molecular weight of 246.26 g/mol. Its IUPAC name is 5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine.
Molecular Properties
| Compound Name | 5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine |
| PubChem CID | 19380417 |
| Molecular Formula | C14H12F2N2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine |
| SMILES | C=CCCc1cnc(-c2ccc(F)c(F)c2)nc1 |
| InChI | InChI=1S/C14H12F2N2/c1-2-3-4-10-8-17-14(18-9-10)11-5-6-12(15)13(16)7-11/h2,5-9H,1,3-4H2 |
| InChIKey | RHKPUQKTFJLXQF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine?
The IUPAC name of 5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine (CID 19380417) is 5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine.
What is the SMILES notation for 5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine?
The canonical SMILES for 5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine is C=CCCc1cnc(-c2ccc(F)c(F)c2)nc1.
What is the InChIKey of 5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine?
The InChIKey is RHKPUQKTFJLXQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2N2/c1-2-3-4-10-8-17-14(18-9-10)11-5-6-12(15)13(16)7-11/h2,5-9H,1,3-4H2.
What are the key properties of 5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine?
5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine has a molecular weight of 246.26 g/mol, XLogP of 3.54, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-3-enyl-2-(3,4-difluorophenyl)pyrimidine is sourced from PubChem (CID 19380417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).