C22H26F2N2 — CID 57168310
5-[2-(4-but-2-enylcyclohexyl)ethyl]-2-(3,4-difluorophenyl)pyrimidine (PubChem CID 57168310) has the molecular formula C22H26F2N2 and a molecular weight of 356.46 g/mol. Its IUPAC name is 5-[2-(4-but-2-enylcyclohexyl)ethyl]-2-(3,4-difluorophenyl)pyrimidine.
| Compound Name | 5-[2-(4-but-2-enylcyclohexyl)ethyl]-2-(3,4-difluorophenyl)pyrimidine |
|---|---|
| PubChem CID | 57168310 |
| Molecular Formula | C22H26F2N2 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 5-[2-(4-but-2-enylcyclohexyl)ethyl]-2-(3,4-difluorophenyl)pyrimidine |
| SMILES | CC=CCC1CCC(CCc2cnc(-c3ccc(F)c(F)c3)nc2)CC1 |
| InChI | InChI=1S/C22H26F2N2/c1-2-3-4-16-5-7-17(8-6-16)9-10-18-14-25-22(26-15-18)19-11-12-20(23)21(24)13-19/h2-3,11-17H,4-10H2,1H3 |
| InChIKey | MJUBACLZYRSHIR-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|