C22H25F2Si — CID 22404137
CID 22404137 (PubChem CID 22404137) has the molecular formula C22H25F2Si and a molecular weight of 355.52 g/mol.
| Compound Name | CID 22404137 |
|---|---|
| PubChem CID | 22404137 |
| Molecular Formula | C22H25F2Si |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | — |
| SMILES | C/C=C/[Si]1CCC(CCc2ccc(-c3ccc(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C22H25F2Si/c1-2-13-25-14-11-18(12-15-25)4-3-17-5-7-19(8-6-17)20-9-10-21(23)22(24)16-20/h2,5-10,13,16,18H,3-4,11-12,14-15H2,1H3/b13-2+ |
| InChIKey | BQSPPISZYPAGRG-XNJYKOPJSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|