C28H36FSi — CID 20632338
CID 20632338 (PubChem CID 20632338) has the molecular formula C28H36FSi and a molecular weight of 419.68 g/mol.
| Compound Name | CID 20632338 |
|---|---|
| PubChem CID | 20632338 |
| Molecular Formula | C28H36FSi |
| Molecular Weight | 419.68 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2ccc(CCC3CCC(C4CCC(C[Si])CC4)CC3)cc2)cc1F |
| InChI | InChI=1S/C28H36FSi/c1-20-2-11-27(18-28(20)29)26-14-7-22(8-15-26)4-3-21-5-12-24(13-6-21)25-16-9-23(19-30)10-17-25/h2,7-8,11,14-15,18,21,23-25H,3-6,9-10,12-13,16-17,19H2,1H3 |
| InChIKey | NZLPNUWTJWWEQM-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.68 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|