C20H31FS — CID 59545823
4-[2-[4-(tert-butylsulfanylmethyl)cyclohexyl]ethyl]-2-fluoro-1-methylbenzene (PubChem CID 59545823) has the molecular formula C20H31FS and a molecular weight of 322.53 g/mol. Its IUPAC name is 4-[2-[4-(tert-butylsulfanylmethyl)cyclohexyl]ethyl]-2-fluoro-1-methylbenzene.
| Compound Name | 4-[2-[4-(tert-butylsulfanylmethyl)cyclohexyl]ethyl]-2-fluoro-1-methylbenzene |
|---|---|
| PubChem CID | 59545823 |
| Molecular Formula | C20H31FS |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 4-[2-[4-(tert-butylsulfanylmethyl)cyclohexyl]ethyl]-2-fluoro-1-methylbenzene |
| SMILES | Cc1ccc(CCC2CCC(CSC(C)(C)C)CC2)cc1F |
| InChI | InChI=1S/C20H31FS/c1-15-5-6-17(13-19(15)21)10-7-16-8-11-18(12-9-16)14-22-20(2,3)4/h5-6,13,16,18H,7-12,14H2,1-4H3 |
| InChIKey | LWLVNXNMQOGACA-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |