C16H21F — CID 139334272
2-fluoro-1-methyl-4-[2-(4-methylcyclohex-2-en-1-yl)ethyl]benzene (PubChem CID 139334272) has the molecular formula C16H21F and a molecular weight of 232.34 g/mol. Its IUPAC name is 2-fluoro-1-methyl-4-[2-(4-methylcyclohex-2-en-1-yl)ethyl]benzene.
| Compound Name | 2-fluoro-1-methyl-4-[2-(4-methylcyclohex-2-en-1-yl)ethyl]benzene |
|---|---|
| PubChem CID | 139334272 |
| Molecular Formula | C16H21F |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2-fluoro-1-methyl-4-[2-(4-methylcyclohex-2-en-1-yl)ethyl]benzene |
| SMILES | Cc1ccc(CCC2C=CC(C)CC2)cc1F |
| InChI | InChI=1S/C16H21F/c1-12-3-6-14(7-4-12)9-10-15-8-5-13(2)16(17)11-15/h3,5-6,8,11-12,14H,4,7,9-10H2,1-2H3 |
| InChIKey | JMRUMUKGWICJOJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|