C11H14FN — CID 63647017
3-[(3-fluoro-4-methylphenyl)methyl]azetidine (PubChem CID 63647017) has the molecular formula C11H14FN and a molecular weight of 179.24 g/mol. Its IUPAC name is 3-[(3-fluoro-4-methylphenyl)methyl]azetidine.
| Compound Name | 3-[(3-fluoro-4-methylphenyl)methyl]azetidine |
|---|---|
| PubChem CID | 63647017 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 3-[(3-fluoro-4-methylphenyl)methyl]azetidine |
| SMILES | Cc1ccc(CC2CNC2)cc1F |
| InChI | InChI=1S/C11H14FN/c1-8-2-3-9(5-11(8)12)4-10-6-13-7-10/h2-3,5,10,13H,4,6-7H2,1H3 |
| InChIKey | MOCKJHAKFPKZKS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |