C11H14BrNO — CID 79452527
3-[(3-bromo-4-methoxyphenyl)methyl]azetidine (PubChem CID 79452527) has the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. Its IUPAC name is 3-[(3-bromo-4-methoxyphenyl)methyl]azetidine.
| Compound Name | 3-[(3-bromo-4-methoxyphenyl)methyl]azetidine |
|---|---|
| PubChem CID | 79452527 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 3-[(3-bromo-4-methoxyphenyl)methyl]azetidine |
| SMILES | COc1ccc(CC2CNC2)cc1Br |
| InChI | InChI=1S/C11H14BrNO/c1-14-11-3-2-8(5-10(11)12)4-9-6-13-7-9/h2-3,5,9,13H,4,6-7H2,1H3 |
| InChIKey | MCQFYIRIYMXLIT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |