C14H20BrClN2O — CID 120660898
(3aR,6aS)-5-[(3-bromo-4-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 120660898) has the molecular formula C14H20BrClN2O and a molecular weight of 347.68 g/mol. Its IUPAC name is (3aR,6aS)-5-[(3-bromo-4-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aR,6aS)-5-[(3-bromo-4-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 120660898 |
| Molecular Formula | C14H20BrClN2O |
| Molecular Weight | 347.68 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | (3aR,6aS)-5-[(3-bromo-4-methoxyphenyl)methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | COc1ccc(CN2C[C@H]3CNC[C@H]3C2)cc1Br.Cl |
| InChI | InChI=1S/C14H19BrN2O.ClH/c1-18-14-3-2-10(4-13(14)15)7-17-8-11-5-16-6-12(11)9-17;/h2-4,11-12,16H,5-9H2,1H3;1H/t11-,12+; |
| InChIKey | OCRAYPUHZSOBCQ-IWKKHLOMSA-N |
| XLogP | 2.53 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.68 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |