C15H21ClF2N2O2 — CID 120660864
(3aS,6aR)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride (PubChem CID 120660864) has the molecular formula C15H21ClF2N2O2 and a molecular weight of 334.79 g/mol. Its IUPAC name is (3aS,6aR)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride.
| Compound Name | (3aS,6aR)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
|---|---|
| PubChem CID | 120660864 |
| Molecular Formula | C15H21ClF2N2O2 |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | (3aS,6aR)-5-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;hydrochloride |
| SMILES | COc1cc(CN2C[C@H]3CNC[C@H]3C2)ccc1OC(F)F.Cl |
| InChI | InChI=1S/C15H20F2N2O2.ClH/c1-20-14-4-10(2-3-13(14)21-15(16)17)7-19-8-11-5-18-6-12(11)9-19;/h2-4,11-12,15,18H,5-9H2,1H3;1H/t11-,12+; |
| InChIKey | CPOMHKFUXDJDAC-IWKKHLOMSA-N |
| XLogP | 2.37 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |