C21H23F2N3O2 — CID 8710918
4-[[4-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]piperazin-1-yl]methyl]benzonitrile (PubChem CID 8710918) has the molecular formula C21H23F2N3O2 and a molecular weight of 387.43 g/mol. Its IUPAC name is 4-[[4-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 8710918 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 4-[[4-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]piperazin-1-yl]methyl]benzonitrile |
| SMILES | COc1cc(CN2CCN(Cc3ccc(C#N)cc3)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C21H23F2N3O2/c1-27-20-12-18(6-7-19(20)28-21(22)23)15-26-10-8-25(9-11-26)14-17-4-2-16(13-24)3-5-17/h2-7,12,21H,8-11,14-15H2,1H3 |
| InChIKey | SSDGMFPXETVQSR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |