C17H20F2N2O4S2 — CID 8553411
1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-4-thiophen-2-ylsulfonylpiperazine (PubChem CID 8553411) has the molecular formula C17H20F2N2O4S2 and a molecular weight of 418.49 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-4-thiophen-2-ylsulfonylpiperazine.
| Compound Name | 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-4-thiophen-2-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 8553411 |
| Molecular Formula | C17H20F2N2O4S2 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-4-thiophen-2-ylsulfonylpiperazine |
| SMILES | COc1cc(CN2CCN(S(=O)(=O)c3cccs3)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C17H20F2N2O4S2/c1-24-15-11-13(4-5-14(15)25-17(18)19)12-20-6-8-21(9-7-20)27(22,23)16-3-2-10-26-16/h2-5,10-11,17H,6-9,12H2,1H3 |
| InChIKey | DCXNPTKJFQFSOC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |