C18H24N2O3S2 — CID 110358219
1-[3-(2-methoxyphenyl)propyl]-4-thiophen-2-ylsulfonylpiperazine (PubChem CID 110358219) has the molecular formula C18H24N2O3S2 and a molecular weight of 380.53 g/mol. Its IUPAC name is 1-[3-(2-methoxyphenyl)propyl]-4-thiophen-2-ylsulfonylpiperazine.
| Compound Name | 1-[3-(2-methoxyphenyl)propyl]-4-thiophen-2-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 110358219 |
| Molecular Formula | C18H24N2O3S2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 1-[3-(2-methoxyphenyl)propyl]-4-thiophen-2-ylsulfonylpiperazine |
| SMILES | COc1ccccc1CCCN1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H24N2O3S2/c1-23-17-8-3-2-6-16(17)7-4-10-19-11-13-20(14-12-19)25(21,22)18-9-5-15-24-18/h2-3,5-6,8-9,15H,4,7,10-14H2,1H3 |
| InChIKey | PIAXPGIDIIIXET-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |