C19H31N3O2 — CID 110358210
N,N-diethyl-4-[3-(2-methoxyphenyl)propyl]piperazine-1-carboxamide (PubChem CID 110358210) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is N,N-diethyl-4-[3-(2-methoxyphenyl)propyl]piperazine-1-carboxamide.
| Compound Name | N,N-diethyl-4-[3-(2-methoxyphenyl)propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110358210 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | N,N-diethyl-4-[3-(2-methoxyphenyl)propyl]piperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(CCCc2ccccc2OC)CC1 |
| InChI | InChI=1S/C19H31N3O2/c1-4-21(5-2)19(23)22-15-13-20(14-16-22)12-8-10-17-9-6-7-11-18(17)24-3/h6-7,9,11H,4-5,8,10,12-16H2,1-3H3 |
| InChIKey | HLDNZGSNRVTQHV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |