C17H27N3O2 — CID 110293203
N,N-diethyl-3-(2-methoxyphenyl)-4-methylpiperazine-1-carboxamide (PubChem CID 110293203) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is N,N-diethyl-3-(2-methoxyphenyl)-4-methylpiperazine-1-carboxamide.
| Compound Name | N,N-diethyl-3-(2-methoxyphenyl)-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 110293203 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | N,N-diethyl-3-(2-methoxyphenyl)-4-methylpiperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(C)C(c2ccccc2OC)C1 |
| InChI | InChI=1S/C17H27N3O2/c1-5-19(6-2)17(21)20-12-11-18(3)15(13-20)14-9-7-8-10-16(14)22-4/h7-10,15H,5-6,11-13H2,1-4H3 |
| InChIKey | OURURMLRJVFWFZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |