C14H22N2O3S — CID 110293209
4-ethylsulfonyl-2-(2-methoxyphenyl)-1-methylpiperazine (PubChem CID 110293209) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-ethylsulfonyl-2-(2-methoxyphenyl)-1-methylpiperazine.
| Compound Name | 4-ethylsulfonyl-2-(2-methoxyphenyl)-1-methylpiperazine |
|---|---|
| PubChem CID | 110293209 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 4-ethylsulfonyl-2-(2-methoxyphenyl)-1-methylpiperazine |
| SMILES | CCS(=O)(=O)N1CCN(C)C(c2ccccc2OC)C1 |
| InChI | InChI=1S/C14H22N2O3S/c1-4-20(17,18)16-10-9-15(2)13(11-16)12-7-5-6-8-14(12)19-3/h5-8,13H,4,9-11H2,1-3H3 |
| InChIKey | RDTXCIFTQDFQAD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |