C17H19F2N3O4S2 — CID 4818683
N-[4-(difluoromethoxy)phenyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide (PubChem CID 4818683) has the molecular formula C17H19F2N3O4S2 and a molecular weight of 431.49 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 4818683 |
| Molecular Formula | C17H19F2N3O4S2 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2cccs2)CC1)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H19F2N3O4S2/c18-17(19)26-14-5-3-13(4-6-14)20-15(23)12-21-7-9-22(10-8-21)28(24,25)16-2-1-11-27-16/h1-6,11,17H,7-10,12H2,(H,20,23) |
| InChIKey | KTPPCZHIFIIBFM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |