C17H20FN3O3S2 — CID 3720770
N-(4-fluorophenyl)-2-(4-thiophen-2-ylsulfonyl-1,4-diazepan-1-yl)acetamide (PubChem CID 3720770) has the molecular formula C17H20FN3O3S2 and a molecular weight of 397.50 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(4-thiophen-2-ylsulfonyl-1,4-diazepan-1-yl)acetamide.
| Compound Name | N-(4-fluorophenyl)-2-(4-thiophen-2-ylsulfonyl-1,4-diazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 3720770 |
| Molecular Formula | C17H20FN3O3S2 |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-(4-fluorophenyl)-2-(4-thiophen-2-ylsulfonyl-1,4-diazepan-1-yl)acetamide |
| SMILES | O=C(CN1CCCN(S(=O)(=O)c2cccs2)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H20FN3O3S2/c18-14-4-6-15(7-5-14)19-16(22)13-20-8-2-9-21(11-10-20)26(23,24)17-3-1-12-25-17/h1,3-7,12H,2,8-11,13H2,(H,19,22) |
| InChIKey | ZKINSHHUYMZEOH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |