C20H22FN3O5S — CID 55366799
methyl 2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]sulfonylbenzoate (PubChem CID 55366799) has the molecular formula C20H22FN3O5S and a molecular weight of 435.48 g/mol. Its IUPAC name is methyl 2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 55366799 |
| Molecular Formula | C20H22FN3O5S |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | methyl 2-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)N1CCN(CC(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H22FN3O5S/c1-29-20(26)17-4-2-3-5-18(17)30(27,28)24-12-10-23(11-13-24)14-19(25)22-16-8-6-15(21)7-9-16/h2-9H,10-14H2,1H3,(H,22,25) |
| InChIKey | LGNOPBFUDPLUNJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |