C16H17F2N3O3S2 — CID 24680339
N-(3,5-difluorophenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide (PubChem CID 24680339) has the molecular formula C16H17F2N3O3S2 and a molecular weight of 401.46 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-(3,5-difluorophenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 24680339 |
| Molecular Formula | C16H17F2N3O3S2 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-(3,5-difluorophenyl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2cccs2)CC1)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H17F2N3O3S2/c17-12-8-13(18)10-14(9-12)19-15(22)11-20-3-5-21(6-4-20)26(23,24)16-2-1-7-25-16/h1-2,7-10H,3-6,11H2,(H,19,22) |
| InChIKey | RPWPKVIAJXBLJP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |