C17H20ClN3O3S2 — CID 2655772
N-[(2-chlorophenyl)methyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide (PubChem CID 2655772) has the molecular formula C17H20ClN3O3S2 and a molecular weight of 413.95 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 2655772 |
| Molecular Formula | C17H20ClN3O3S2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2cccs2)CC1)NCc1ccccc1Cl |
| InChI | InChI=1S/C17H20ClN3O3S2/c18-15-5-2-1-4-14(15)12-19-16(22)13-20-7-9-21(10-8-20)26(23,24)17-6-3-11-25-17/h1-6,11H,7-10,12-13H2,(H,19,22) |
| InChIKey | ZYRDFEYKOHMTIY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |