C18H22ClN3O3S2 — CID 24680288
N-[(2-chlorophenyl)methyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propanamide (PubChem CID 24680288) has the molecular formula C18H22ClN3O3S2 and a molecular weight of 427.98 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 24680288 |
| Molecular Formula | C18H22ClN3O3S2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propanamide |
| SMILES | CC(C(=O)NCc1ccccc1Cl)N1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H22ClN3O3S2/c1-14(18(23)20-13-15-5-2-3-6-16(15)19)21-8-10-22(11-9-21)27(24,25)17-7-4-12-26-17/h2-7,12,14H,8-11,13H2,1H3,(H,20,23) |
| InChIKey | XTEMQXRPWXYPRB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |