C19H25N3O3S2 — CID 8512379
(2R)-N-benzyl-N-methyl-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propanamide (PubChem CID 8512379) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is (2R)-N-benzyl-N-methyl-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propanamide.
| Compound Name | (2R)-N-benzyl-N-methyl-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 8512379 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (2R)-N-benzyl-N-methyl-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propanamide |
| SMILES | C[C@H](C(=O)N(C)Cc1ccccc1)N1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C19H25N3O3S2/c1-16(19(23)20(2)15-17-7-4-3-5-8-17)21-10-12-22(13-11-21)27(24,25)18-9-6-14-26-18/h3-9,14,16H,10-13,15H2,1-2H3/t16-/m1/s1 |
| InChIKey | NBLDPJCGHREQCG-MRXNPFEDSA-N |
| XLogP | 2.10 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |