C21H27N3O — CID 42858943
N-benzyl-N-methyl-2-(4-phenylpiperazin-1-yl)propanamide (PubChem CID 42858943) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-(4-phenylpiperazin-1-yl)propanamide.
| Compound Name | N-benzyl-N-methyl-2-(4-phenylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 42858943 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | N-benzyl-N-methyl-2-(4-phenylpiperazin-1-yl)propanamide |
| SMILES | CC(C(=O)N(C)Cc1ccccc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H27N3O/c1-18(21(25)22(2)17-19-9-5-3-6-10-19)23-13-15-24(16-14-23)20-11-7-4-8-12-20/h3-12,18H,13-17H2,1-2H3 |
| InChIKey | NALDFGAZKZHXHU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |