C19H23ClN2O3S2 — CID 95088661
(2R)-N-[(4-chlorophenyl)methyl]-2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)propanamide (PubChem CID 95088661) has the molecular formula C19H23ClN2O3S2 and a molecular weight of 426.99 g/mol. Its IUPAC name is (2R)-N-[(4-chlorophenyl)methyl]-2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)propanamide.
| Compound Name | (2R)-N-[(4-chlorophenyl)methyl]-2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 95088661 |
| Molecular Formula | C19H23ClN2O3S2 |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | (2R)-N-[(4-chlorophenyl)methyl]-2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)propanamide |
| SMILES | C[C@@H](C(=O)NCc1ccc(Cl)cc1)C1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C19H23ClN2O3S2/c1-14(19(23)21-13-15-4-6-17(20)7-5-15)16-8-10-22(11-9-16)27(24,25)18-3-2-12-26-18/h2-7,12,14,16H,8-11,13H2,1H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | BSXNJTYVKCBUIM-CQSZACIVSA-N |
| XLogP | 3.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |