C19H31N3O4S2 — CID 53118897
N-(3-morpholin-4-ylpropyl)-2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)propanamide (PubChem CID 53118897) has the molecular formula C19H31N3O4S2 and a molecular weight of 429.61 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)propanamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 53118897 |
| Molecular Formula | C19H31N3O4S2 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)propanamide |
| SMILES | CC(C(=O)NCCCN1CCOCC1)C1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C19H31N3O4S2/c1-16(19(23)20-7-3-8-21-11-13-26-14-12-21)17-5-9-22(10-6-17)28(24,25)18-4-2-15-27-18/h2,4,15-17H,3,5-14H2,1H3,(H,20,23) |
| InChIKey | IEOZOLHTJCFEQW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|