C20H32ClN3O3S2 — CID 53031704
2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-(3-piperidin-1-ylpropyl)propanamide (PubChem CID 53031704) has the molecular formula C20H32ClN3O3S2 and a molecular weight of 462.08 g/mol. Its IUPAC name is 2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-(3-piperidin-1-ylpropyl)propanamide.
| Compound Name | 2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-(3-piperidin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 53031704 |
| Molecular Formula | C20H32ClN3O3S2 |
| Molecular Weight | 462.08 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-(3-piperidin-1-ylpropyl)propanamide |
| SMILES | CC(C(=O)NCCCN1CCCCC1)C1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C20H32ClN3O3S2/c1-16(20(25)22-10-5-13-23-11-3-2-4-12-23)17-8-14-24(15-9-17)29(26,27)19-7-6-18(21)28-19/h6-7,16-17H,2-5,8-15H2,1H3,(H,22,25) |
| InChIKey | GWMQEDAIWCUPJN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.08 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|