C18H28ClN3O3S2 — CID 53118995
2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-(3-pyrrolidin-1-ylpropyl)acetamide (PubChem CID 53118995) has the molecular formula C18H28ClN3O3S2 and a molecular weight of 434.03 g/mol. Its IUPAC name is 2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-(3-pyrrolidin-1-ylpropyl)acetamide.
| Compound Name | 2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-(3-pyrrolidin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 53118995 |
| Molecular Formula | C18H28ClN3O3S2 |
| Molecular Weight | 434.03 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-N-(3-pyrrolidin-1-ylpropyl)acetamide |
| SMILES | O=C(CC1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1)NCCCN1CCCC1 |
| InChI | InChI=1S/C18H28ClN3O3S2/c19-16-4-5-18(26-16)27(24,25)22-12-6-15(7-13-22)14-17(23)20-8-3-11-21-9-1-2-10-21/h4-5,15H,1-3,6-14H2,(H,20,23) |
| InChIKey | HVZWSQOYVQKFOG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.03 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|