C13H19ClN2O4S2 — CID 119135118
4-[4-(5-chlorothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]butanoic acid (PubChem CID 119135118) has the molecular formula C13H19ClN2O4S2 and a molecular weight of 366.89 g/mol. Its IUPAC name is 4-[4-(5-chlorothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]butanoic acid.
| Compound Name | 4-[4-(5-chlorothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]butanoic acid |
|---|---|
| PubChem CID | 119135118 |
| Molecular Formula | C13H19ClN2O4S2 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 4-[4-(5-chlorothiophen-2-yl)sulfonyl-1,4-diazepan-1-yl]butanoic acid |
| SMILES | O=C(O)CCCN1CCCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C13H19ClN2O4S2/c14-11-4-5-13(21-11)22(19,20)16-8-2-7-15(9-10-16)6-1-3-12(17)18/h4-5H,1-3,6-10H2,(H,17,18) |
| InChIKey | GOMWAAZWAOJDTD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |