C15H24ClN3O3S2 — CID 60575695
4-[3-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]propyl]morpholine (PubChem CID 60575695) has the molecular formula C15H24ClN3O3S2 and a molecular weight of 393.96 g/mol. Its IUPAC name is 4-[3-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]propyl]morpholine.
| Compound Name | 4-[3-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]propyl]morpholine |
|---|---|
| PubChem CID | 60575695 |
| Molecular Formula | C15H24ClN3O3S2 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 4-[3-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]propyl]morpholine |
| SMILES | O=S(=O)(c1ccc(Cl)s1)N1CCN(CCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C15H24ClN3O3S2/c16-14-2-3-15(23-14)24(20,21)19-8-6-17(7-9-19)4-1-5-18-10-12-22-13-11-18/h2-3H,1,4-13H2 |
| InChIKey | AGRMDFXQDYDOPF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |