C16H19ClN2O3S2 — CID 9248165
(1R)-2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-1-phenylethanol (PubChem CID 9248165) has the molecular formula C16H19ClN2O3S2 and a molecular weight of 386.93 g/mol. Its IUPAC name is (1R)-2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-1-phenylethanol.
| Compound Name | (1R)-2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 9248165 |
| Molecular Formula | C16H19ClN2O3S2 |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | (1R)-2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-1-phenylethanol |
| SMILES | O=S(=O)(c1ccc(Cl)s1)N1CCN(C[C@H](O)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H19ClN2O3S2/c17-15-6-7-16(23-15)24(21,22)19-10-8-18(9-11-19)12-14(20)13-4-2-1-3-5-13/h1-7,14,20H,8-12H2/t14-/m0/s1 |
| InChIKey | NQYXGXZPSRRQTJ-AWEZNQCLSA-N |
| XLogP | 2.44 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |