C18H29N3O3S — CID 31690686
(1R)-2-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-1-phenylethanol (PubChem CID 31690686) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is (1R)-2-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-1-phenylethanol.
| Compound Name | (1R)-2-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 31690686 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (1R)-2-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-1-phenylethanol |
| SMILES | O=S(=O)(N1CCCCCC1)N1CCN(C[C@H](O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H29N3O3S/c22-18(17-8-4-3-5-9-17)16-19-12-14-21(15-13-19)25(23,24)20-10-6-1-2-7-11-20/h3-5,8-9,18,22H,1-2,6-7,10-16H2/t18-/m0/s1 |
| InChIKey | GFTMTBYVKDWSNV-SFHVURJKSA-N |
| XLogP | 1.46 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |