C19H31N3O3S — CID 46968099
1-(2,5-dimethylphenyl)-2-(4-piperidin-1-ylsulfonylpiperazin-1-yl)ethanol (PubChem CID 46968099) has the molecular formula C19H31N3O3S and a molecular weight of 381.54 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2-(4-piperidin-1-ylsulfonylpiperazin-1-yl)ethanol.
| Compound Name | 1-(2,5-dimethylphenyl)-2-(4-piperidin-1-ylsulfonylpiperazin-1-yl)ethanol |
|---|---|
| PubChem CID | 46968099 |
| Molecular Formula | C19H31N3O3S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2-(4-piperidin-1-ylsulfonylpiperazin-1-yl)ethanol |
| SMILES | Cc1ccc(C)c(C(O)CN2CCN(S(=O)(=O)N3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C19H31N3O3S/c1-16-6-7-17(2)18(14-16)19(23)15-20-10-12-22(13-11-20)26(24,25)21-8-4-3-5-9-21/h6-7,14,19,23H,3-5,8-13,15H2,1-2H3 |
| InChIKey | ZJSRVVGXBMNAEZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |