C19H24ClN3O3S2 — CID 55365337
2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-N-methyl-N-(1-phenylethyl)acetamide (PubChem CID 55365337) has the molecular formula C19H24ClN3O3S2 and a molecular weight of 442.01 g/mol. Its IUPAC name is 2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-N-methyl-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-N-methyl-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 55365337 |
| Molecular Formula | C19H24ClN3O3S2 |
| Molecular Weight | 442.01 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-N-methyl-N-(1-phenylethyl)acetamide |
| SMILES | CC(c1ccccc1)N(C)C(=O)CN1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C19H24ClN3O3S2/c1-15(16-6-4-3-5-7-16)21(2)18(24)14-22-10-12-23(13-11-22)28(25,26)19-9-8-17(20)27-19/h3-9,15H,10-14H2,1-2H3 |
| InChIKey | NCHAYEYQFUWTPQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.01 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |