C15H23ClN4O4S2 — CID 9304405
2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-N-(2-methylpropylcarbamoyl)acetamide (PubChem CID 9304405) has the molecular formula C15H23ClN4O4S2 and a molecular weight of 422.96 g/mol. Its IUPAC name is 2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-N-(2-methylpropylcarbamoyl)acetamide.
| Compound Name | 2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-N-(2-methylpropylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 9304405 |
| Molecular Formula | C15H23ClN4O4S2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-N-(2-methylpropylcarbamoyl)acetamide |
| SMILES | CC(C)CNC(=O)NC(=O)CN1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C15H23ClN4O4S2/c1-11(2)9-17-15(22)18-13(21)10-19-5-7-20(8-6-19)26(23,24)14-4-3-12(16)25-14/h3-4,11H,5-10H2,1-2H3,(H2,17,18,21,22) |
| InChIKey | NOVRXLGABSWNAG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |