C13H19ClN4O4S2 — CID 9304383
(2S)-2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-N-(methylcarbamoyl)propanamide (PubChem CID 9304383) has the molecular formula C13H19ClN4O4S2 and a molecular weight of 394.91 g/mol. Its IUPAC name is (2S)-2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-N-(methylcarbamoyl)propanamide.
| Compound Name | (2S)-2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 9304383 |
| Molecular Formula | C13H19ClN4O4S2 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | (2S)-2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)[C@H](C)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C13H19ClN4O4S2/c1-9(12(19)16-13(20)15-2)17-5-7-18(8-6-17)24(21,22)11-4-3-10(14)23-11/h3-4,9H,5-8H2,1-2H3,(H2,15,16,19,20)/t9-/m0/s1 |
| InChIKey | QZJZHZKLBQFLCH-VIFPVBQESA-N |
| XLogP | 0.55 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |