C16H27N3O3S2 — CID 17457260
N-tert-butyl-2-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]propanamide (PubChem CID 17457260) has the molecular formula C16H27N3O3S2 and a molecular weight of 373.54 g/mol. Its IUPAC name is N-tert-butyl-2-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]propanamide.
| Compound Name | N-tert-butyl-2-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 17457260 |
| Molecular Formula | C16H27N3O3S2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-tert-butyl-2-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(C)C(=O)NC(C)(C)C)CC2)s1 |
| InChI | InChI=1S/C16H27N3O3S2/c1-12-6-7-14(23-12)24(21,22)19-10-8-18(9-11-19)13(2)15(20)17-16(3,4)5/h6-7,13H,8-11H2,1-5H3,(H,17,20) |
| InChIKey | JSHHGQJCIIZQRK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |