C15H25N3O3S2 — CID 51935304
4-(5-methylthiophen-2-yl)sulfonyl-N-[(2R)-pentan-2-yl]piperazine-1-carboxamide (PubChem CID 51935304) has the molecular formula C15H25N3O3S2 and a molecular weight of 359.52 g/mol. Its IUPAC name is 4-(5-methylthiophen-2-yl)sulfonyl-N-[(2R)-pentan-2-yl]piperazine-1-carboxamide.
| Compound Name | 4-(5-methylthiophen-2-yl)sulfonyl-N-[(2R)-pentan-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 51935304 |
| Molecular Formula | C15H25N3O3S2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-(5-methylthiophen-2-yl)sulfonyl-N-[(2R)-pentan-2-yl]piperazine-1-carboxamide |
| SMILES | CCC[C@@H](C)NC(=O)N1CCN(S(=O)(=O)c2ccc(C)s2)CC1 |
| InChI | InChI=1S/C15H25N3O3S2/c1-4-5-12(2)16-15(19)17-8-10-18(11-9-17)23(20,21)14-7-6-13(3)22-14/h6-7,12H,4-5,8-11H2,1-3H3,(H,16,19)/t12-/m1/s1 |
| InChIKey | KEXPGCLMHPZTJU-GFCCVEGCSA-N |
| XLogP | 2.26 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |