C17H27N3O3S2 — CID 26390006
1-(azepan-1-yl)-2-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 26390006) has the molecular formula C17H27N3O3S2 and a molecular weight of 385.56 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 26390006 |
| Molecular Formula | C17H27N3O3S2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-(azepan-1-yl)-2-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CC(=O)N3CCCCCC3)CC2)s1 |
| InChI | InChI=1S/C17H27N3O3S2/c1-15-6-7-17(24-15)25(22,23)20-12-10-18(11-13-20)14-16(21)19-8-4-2-3-5-9-19/h6-7H,2-5,8-14H2,1H3 |
| InChIKey | AKWBOESFOWCDKZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |