C15H18N2O3S3 — CID 33176973
1-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]-2-thiophen-2-ylethanone (PubChem CID 33176973) has the molecular formula C15H18N2O3S3 and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 33176973 |
| Molecular Formula | C15H18N2O3S3 |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 1-[4-(5-methylthiophen-2-yl)sulfonylpiperazin-1-yl]-2-thiophen-2-ylethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)Cc3cccs3)CC2)s1 |
| InChI | InChI=1S/C15H18N2O3S3/c1-12-4-5-15(22-12)23(19,20)17-8-6-16(7-9-17)14(18)11-13-3-2-10-21-13/h2-5,10H,6-9,11H2,1H3 |
| InChIKey | RDZFYSQOMTXGLD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |