C18H21N3O4S2 — CID 108569277
N-[4-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]sulfonylphenyl]acetamide (PubChem CID 108569277) has the molecular formula C18H21N3O4S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-[4-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 108569277 |
| Molecular Formula | C18H21N3O4S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | N-[4-[4-(2-thiophen-2-ylacetyl)piperazin-1-yl]sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCN(C(=O)Cc3cccs3)CC2)cc1 |
| InChI | InChI=1S/C18H21N3O4S2/c1-14(22)19-15-4-6-17(7-5-15)27(24,25)21-10-8-20(9-11-21)18(23)13-16-3-2-12-26-16/h2-7,12H,8-11,13H2,1H3,(H,19,22) |
| InChIKey | BOCCJKDQILOJKA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |