C19H24N2O4S2 — CID 2458753
1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-4-thiophen-2-ylbutan-1-one (PubChem CID 2458753) has the molecular formula C19H24N2O4S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 2458753 |
| Molecular Formula | C19H24N2O4S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-4-thiophen-2-ylbutan-1-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C(=O)CCCc3cccs3)CC2)cc1 |
| InChI | InChI=1S/C19H24N2O4S2/c1-25-16-7-9-18(10-8-16)27(23,24)21-13-11-20(12-14-21)19(22)6-2-4-17-5-3-15-26-17/h3,5,7-10,15H,2,4,6,11-14H2,1H3 |
| InChIKey | BRPKBJCALQHOEM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |